C15H18N6O3 — CID 131673740
2-methyl-1'-(1-methylpyrazole-3-carbonyl)spiro[6,8-dihydropyrrolo[2,1-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione (PubChem CID 131673740) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-methyl-1'-(1-methylpyrazole-3-carbonyl)spiro[6,8-dihydropyrrolo[2,1-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione.
| Compound Name | 2-methyl-1'-(1-methylpyrazole-3-carbonyl)spiro[6,8-dihydropyrrolo[2,1-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
|---|---|
| PubChem CID | 131673740 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-methyl-1'-(1-methylpyrazole-3-carbonyl)spiro[6,8-dihydropyrrolo[2,1-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
| SMILES | Cn1ccc(C(=O)N2CCC3(Cc4nn(C)c(=O)c(=O)n4C3)C2)n1 |
| InChI | InChI=1S/C15H18N6O3/c1-18-5-3-10(16-18)12(22)20-6-4-15(8-20)7-11-17-19(2)13(23)14(24)21(11)9-15/h3,5H,4,6-9H2,1-2H3 |
| InChIKey | RDUGXNBIXCXITJ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 95.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|