C8H9IN2 — CID 131675074
4-methylpyrrolo[3,2-b]pyridine;hydroiodide (PubChem CID 131675074) has the molecular formula C8H9IN2 and a molecular weight of 260.08 g/mol. Its IUPAC name is 4-methylpyrrolo[3,2-b]pyridine;hydroiodide.
| Compound Name | 4-methylpyrrolo[3,2-b]pyridine;hydroiodide |
|---|---|
| PubChem CID | 131675074 |
| Molecular Formula | C8H9IN2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 4-methylpyrrolo[3,2-b]pyridine;hydroiodide |
| SMILES | Cn1cccc2nccc1-2.I |
| InChI | InChI=1S/C8H8N2.HI/c1-10-6-2-3-7-8(10)4-5-9-7;/h2-6H,1H3;1H |
| InChIKey | HOWWXDWKSAKDEA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|