C16H25N5O2 — CID 131680314
(1-methyl-1,2,4-triazol-3-yl)-(11-prop-2-enyl-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl)methanone (PubChem CID 131680314) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl)-(11-prop-2-enyl-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl)methanone.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl)-(11-prop-2-enyl-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl)methanone |
|---|---|
| PubChem CID | 131680314 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl)-(11-prop-2-enyl-8-oxa-3,11-diazaspiro[5.6]dodecan-3-yl)methanone |
| SMILES | C=CCN1CCOCC2(CCN(C(=O)c3ncn(C)n3)CC2)C1 |
| InChI | InChI=1S/C16H25N5O2/c1-3-6-20-9-10-23-12-16(11-20)4-7-21(8-5-16)15(22)14-17-13-19(2)18-14/h3,13H,1,4-12H2,2H3 |
| InChIKey | MHYQAPYJFJBUEV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|