C25H30N2O3 — CID 131682351
N-[4-[1-(2-methylbutanoyl)spiro[2H-indole-3,4'-oxane]-5-yl]phenyl]acetamide (PubChem CID 131682351) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[4-[1-(2-methylbutanoyl)spiro[2H-indole-3,4'-oxane]-5-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-(2-methylbutanoyl)spiro[2H-indole-3,4'-oxane]-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 131682351 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[4-[1-(2-methylbutanoyl)spiro[2H-indole-3,4'-oxane]-5-yl]phenyl]acetamide |
| SMILES | CCC(C)C(=O)N1CC2(CCOCC2)c2cc(-c3ccc(NC(C)=O)cc3)ccc21 |
| InChI | InChI=1S/C25H30N2O3/c1-4-17(2)24(29)27-16-25(11-13-30-14-12-25)22-15-20(7-10-23(22)27)19-5-8-21(9-6-19)26-18(3)28/h5-10,15,17H,4,11-14,16H2,1-3H3,(H,26,28) |
| InChIKey | VRUDQTMSSYUQOT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |