C19H25FN2O3 — CID 97409703
(3S)-N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]oxolane-3-carboxamide (PubChem CID 97409703) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is (3S)-N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]oxolane-3-carboxamide.
| Compound Name | (3S)-N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 97409703 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3S)-N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]oxolane-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(CCOCC1)CN2CCF)[C@H]1CCOC1 |
| InChI | InChI=1S/C19H25FN2O3/c20-6-7-22-13-19(4-9-24-10-5-19)16-11-15(1-2-17(16)22)21-18(23)14-3-8-25-12-14/h1-2,11,14H,3-10,12-13H2,(H,21,23)/t14-/m0/s1 |
| InChIKey | VZHYFAZRAQBTAZ-AWEZNQCLSA-N |
| XLogP | 2.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|