C21H30N4O2 — CID 134074322
N-[1-(cyclopropylmethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-5-methylpyrazolidine-3-carboxamide (PubChem CID 134074322) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[1-(cyclopropylmethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-5-methylpyrazolidine-3-carboxamide.
| Compound Name | N-[1-(cyclopropylmethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-5-methylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134074322 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[1-(cyclopropylmethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-5-methylpyrazolidine-3-carboxamide |
| SMILES | CC1CC(C(=O)Nc2ccc3c(c2)C2(CCOCC2)CN3CC2CC2)NN1 |
| InChI | InChI=1S/C21H30N4O2/c1-14-10-18(24-23-14)20(26)22-16-4-5-19-17(11-16)21(6-8-27-9-7-21)13-25(19)12-15-2-3-15/h4-5,11,14-15,18,23-24H,2-3,6-10,12-13H2,1H3,(H,22,26) |
| InChIKey | VFTXWENHECPRKC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|