C22H33N3O3 — CID 134808469
N-(3-hydroxypropyl)-1'-methyl-1-(oxan-4-ylmethyl)spiro[2H-indole-3,3'-pyrrolidine]-5-carboxamide (PubChem CID 134808469) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1'-methyl-1-(oxan-4-ylmethyl)spiro[2H-indole-3,3'-pyrrolidine]-5-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1'-methyl-1-(oxan-4-ylmethyl)spiro[2H-indole-3,3'-pyrrolidine]-5-carboxamide |
|---|---|
| PubChem CID | 134808469 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-(3-hydroxypropyl)-1'-methyl-1-(oxan-4-ylmethyl)spiro[2H-indole-3,3'-pyrrolidine]-5-carboxamide |
| SMILES | CN1CCC2(C1)CN(CC1CCOCC1)c1ccc(C(=O)NCCCO)cc12 |
| InChI | InChI=1S/C22H33N3O3/c1-24-9-7-22(15-24)16-25(14-17-5-11-28-12-6-17)20-4-3-18(13-19(20)22)21(27)23-8-2-10-26/h3-4,13,17,26H,2,5-12,14-16H2,1H3,(H,23,27) |
| InChIKey | YYRFPTWSDYZXPR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|