C23H25N3O2 — CID 134079469
N-(1-pyridin-3-ylspiro[2H-indole-3,4'-oxane]-5-yl)cyclopent-3-ene-1-carboxamide (PubChem CID 134079469) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(1-pyridin-3-ylspiro[2H-indole-3,4'-oxane]-5-yl)cyclopent-3-ene-1-carboxamide.
| Compound Name | N-(1-pyridin-3-ylspiro[2H-indole-3,4'-oxane]-5-yl)cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 134079469 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(1-pyridin-3-ylspiro[2H-indole-3,4'-oxane]-5-yl)cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C1(CCOCC1)CN2c1cccnc1)C1CC=CC1 |
| InChI | InChI=1S/C23H25N3O2/c27-22(17-4-1-2-5-17)25-18-7-8-21-20(14-18)23(9-12-28-13-10-23)16-26(21)19-6-3-11-24-15-19/h1-3,6-8,11,14-15,17H,4-5,9-10,12-13,16H2,(H,25,27) |
| InChIKey | DRLQIVHBWZBPFA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|