C18H25FN2O2 — CID 97401206
N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-2-methylpropanamide (PubChem CID 97401206) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-2-methylpropanamide.
| Compound Name | N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 97401206 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[1-(2-fluoroethyl)spiro[2H-indole-3,4'-oxane]-5-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C1(CCOCC1)CN2CCF |
| InChI | InChI=1S/C18H25FN2O2/c1-13(2)17(22)20-14-3-4-16-15(11-14)18(5-9-23-10-6-18)12-21(16)8-7-19/h3-4,11,13H,5-10,12H2,1-2H3,(H,20,22) |
| InChIKey | VIDIMOKTXYUCSC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|