C16H20F2N6O — CID 131683004
(3,3-difluorocyclobutyl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone (PubChem CID 131683004) has the molecular formula C16H20F2N6O and a molecular weight of 350.37 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131683004 |
| Molecular Formula | C16H20F2N6O |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
| SMILES | Cc1cnnn1Cc1ncn2c1CN(C(=O)C1CC(F)(F)C1)CCC2 |
| InChI | InChI=1S/C16H20F2N6O/c1-11-7-20-21-24(11)8-13-14-9-22(3-2-4-23(14)10-19-13)15(25)12-5-16(17,18)6-12/h7,10,12H,2-6,8-9H2,1H3 |
| InChIKey | YYRIMTCYKYHLDV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |