C17H23F3N6O2 — CID 155838848
8-(cyclopropylmethyl)-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155838848) has the molecular formula C17H23F3N6O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(cyclopropylmethyl)-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838848 |
| Molecular Formula | C17H23F3N6O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 8-(cyclopropylmethyl)-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cnnn1Cc1ncn2c1CN(CC1CC1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N6.C2HF3O2/c1-12-7-17-18-21(12)9-14-15-10-19(8-13-3-4-13)5-2-6-20(15)11-16-14;3-2(4,5)1(6)7/h7,11,13H,2-6,8-10H2,1H3;(H,6,7) |
| InChIKey | XKAJLZGOQOSVSB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |