C17H23F3N6O3 — CID 155854106
7-(oxolan-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155854106) has the molecular formula C17H23F3N6O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 7-(oxolan-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(oxolan-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854106 |
| Molecular Formula | C17H23F3N6O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 7-(oxolan-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncn(Cc2cnc3n2CCN(CC2CCOC2)CC3)n1 |
| InChI | InChI=1S/C15H22N6O.C2HF3O2/c1-3-19(8-13-2-6-22-10-13)4-5-21-14(7-17-15(1)21)9-20-12-16-11-18-20;3-2(4,5)1(6)7/h7,11-13H,1-6,8-10H2;(H,6,7) |
| InChIKey | JIAPBRGQPKOSOR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |