C16H21F3N6O3 — CID 155844401
7-(oxolan-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid (PubChem CID 155844401) has the molecular formula C16H21F3N6O3 and a molecular weight of 402.38 g/mol. Its IUPAC name is 7-(oxolan-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(oxolan-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844401 |
| Molecular Formula | C16H21F3N6O3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 7-(oxolan-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncn(Cc2cn3c(n2)CN(CC2CCOC2)CC3)n1 |
| InChI | InChI=1S/C14H20N6O.C2HF3O2/c1-4-21-9-12(1)5-18-2-3-19-6-13(17-14(19)8-18)7-20-11-15-10-16-20;3-2(4,5)1(6)7/h6,10-12H,1-5,7-9H2;(H,6,7) |
| InChIKey | AHKYKJRWIKAVLB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |