C16H23F3N4O2 — CID 131685471
2-[(1S,3aR,7aR)-5-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide (PubChem CID 131685471) has the molecular formula C16H23F3N4O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-5-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1S,3aR,7aR)-5-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 131685471 |
| Molecular Formula | C16H23F3N4O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[(1S,3aR,7aR)-5-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@@H]1OC[C@H]2CN(Cc3ncc(C(F)(F)F)[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C16H23F3N4O2/c1-22(2)15(24)5-12-11-3-4-23(7-10(11)9-25-12)8-14-20-6-13(21-14)16(17,18)19/h6,10-12H,3-5,7-9H2,1-2H3,(H,20,21)/t10-,11-,12+/m1/s1 |
| InChIKey | NYPOQYIZAULTQX-UTUOFQBUSA-N |
| XLogP | 1.74 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |