C19H32N2O2 — CID 131689595
(1-methylcyclohex-3-en-1-yl)-(4-propan-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl)methanone (PubChem CID 131689595) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (1-methylcyclohex-3-en-1-yl)-(4-propan-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl)methanone.
| Compound Name | (1-methylcyclohex-3-en-1-yl)-(4-propan-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl)methanone |
|---|---|
| PubChem CID | 131689595 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (1-methylcyclohex-3-en-1-yl)-(4-propan-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl)methanone |
| SMILES | CC(C)N1CCOC2CN(C(=O)C3(C)CC=CCC3)CCC2C1 |
| InChI | InChI=1S/C19H32N2O2/c1-15(2)20-11-12-23-17-14-21(10-7-16(17)13-20)18(22)19(3)8-5-4-6-9-19/h4-5,15-17H,6-14H2,1-3H3 |
| InChIKey | IWJBYZZEHNSPCO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|