C15H24N2O — CID 131685836
[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methylcyclohex-3-en-1-yl)methanone (PubChem CID 131685836) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methylcyclohex-3-en-1-yl)methanone.
| Compound Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methylcyclohex-3-en-1-yl)methanone |
|---|---|
| PubChem CID | 131685836 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methylcyclohex-3-en-1-yl)methanone |
| SMILES | CN1C[C@@H]2CCN(C(=O)C3(C)CC=CCC3)[C@@H]2C1 |
| InChI | InChI=1S/C15H24N2O/c1-15(7-4-3-5-8-15)14(18)17-9-6-12-10-16(2)11-13(12)17/h3-4,12-13H,5-11H2,1-2H3/t12-,13+,15?/m0/s1 |
| InChIKey | XUCFAZGSGHHCQK-IKCIUXDWSA-N |
| XLogP | 1.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|