C12H19FN2O — CID 131686062
[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclobutyl)methanone (PubChem CID 131686062) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclobutyl)methanone.
| Compound Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 131686062 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclobutyl)methanone |
| SMILES | CN1C[C@@H]2CCN(C(=O)C3(F)CCC3)[C@@H]2C1 |
| InChI | InChI=1S/C12H19FN2O/c1-14-7-9-3-6-15(10(9)8-14)11(16)12(13)4-2-5-12/h9-10H,2-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | GSDLCEMFOLHQEP-VHSXEESVSA-N |
| XLogP | 1.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |