C16H18N2O — CID 166281850
1-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-phenylprop-2-yn-1-one (PubChem CID 166281850) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-phenylprop-2-yn-1-one.
| Compound Name | 1-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 166281850 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-phenylprop-2-yn-1-one |
| SMILES | CN1C[C@@H]2CCN(C(=O)C#Cc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C16H18N2O/c1-17-11-14-9-10-18(15(14)12-17)16(19)8-7-13-5-3-2-4-6-13/h2-6,14-15H,9-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | ZDSHMNYPUORPNW-LSDHHAIUSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|