C16H20FN3O — CID 131685837
[(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 131685837) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone.
| Compound Name | [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 131685837 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | O=C(N1CC[C@H]2CN(Cc3cccnc3)C[C@H]21)C1(F)CC1 |
| InChI | InChI=1S/C16H20FN3O/c17-16(4-5-16)15(21)20-7-3-13-10-19(11-14(13)20)9-12-2-1-6-18-8-12/h1-2,6,8,13-14H,3-5,7,9-11H2/t13-,14+/m0/s1 |
| InChIKey | YAAJQQOWZNJNHO-UONOGXRCSA-N |
| XLogP | 1.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |