C16H20N6O — CID 131686175
[(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone (PubChem CID 131686175) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 131686175 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(3aS,6aS)-5-(pyridin-3-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cn1cnc(C(=O)N2CC[C@H]3CN(Cc4cccnc4)C[C@H]32)n1 |
| InChI | InChI=1S/C16H20N6O/c1-20-11-18-15(19-20)16(23)22-6-4-13-9-21(10-14(13)22)8-12-3-2-5-17-7-12/h2-3,5,7,11,13-14H,4,6,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | FBGGBESGUBWLAQ-UONOGXRCSA-N |
| XLogP | 0.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |