C19H19ClN4O2 — CID 131689971
(5S,9S)-7-(6-chloropyridine-2-carbonyl)-9-methyl-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131689971) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is (5S,9S)-7-(6-chloropyridine-2-carbonyl)-9-methyl-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S,9S)-7-(6-chloropyridine-2-carbonyl)-9-methyl-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131689971 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (5S,9S)-7-(6-chloropyridine-2-carbonyl)-9-methyl-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C[C@@H]1CN(C(=O)c2cccc(Cl)n2)C[C@]12CCN(c1cccnc1)C2=O |
| InChI | InChI=1S/C19H19ClN4O2/c1-13-11-23(17(25)15-5-2-6-16(20)22-15)12-19(13)7-9-24(18(19)26)14-4-3-8-21-10-14/h2-6,8,10,13H,7,9,11-12H2,1H3/t13-,19-/m1/s1 |
| InChIKey | FDZROJYKTKXMMA-BFUOFWGJSA-N |
| XLogP | 2.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|