C18H18ClN5O3 — CID 131696796
9-(6-chloropyridine-2-carbonyl)-4-pyrimidin-5-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 131696796) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is 9-(6-chloropyridine-2-carbonyl)-4-pyrimidin-5-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-(6-chloropyridine-2-carbonyl)-4-pyrimidin-5-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 131696796 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 9-(6-chloropyridine-2-carbonyl)-4-pyrimidin-5-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C(c1cccc(Cl)n1)N1CCC2(CC1)CN(c1cncnc1)C(=O)CO2 |
| InChI | InChI=1S/C18H18ClN5O3/c19-15-3-1-2-14(22-15)17(26)23-6-4-18(5-7-23)11-24(16(25)10-27-18)13-8-20-12-21-9-13/h1-3,8-9,12H,4-7,10-11H2 |
| InChIKey | KKEUIHRLTBBAKN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|