C15H17N9O — CID 131691086
(1-methyl-1,2,4-triazol-3-yl)-[3-[(pyridin-3-ylamino)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 131691086) has the molecular formula C15H17N9O and a molecular weight of 339.36 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl)-[3-[(pyridin-3-ylamino)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl)-[3-[(pyridin-3-ylamino)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 131691086 |
| Molecular Formula | C15H17N9O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl)-[3-[(pyridin-3-ylamino)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | Cn1cnc(C(=O)N2CCn3c(CNc4cccnc4)nnc3C2)n1 |
| InChI | InChI=1S/C15H17N9O/c1-22-10-18-14(21-22)15(25)23-5-6-24-12(19-20-13(24)9-23)8-17-11-3-2-4-16-7-11/h2-4,7,10,17H,5-6,8-9H2,1H3 |
| InChIKey | UQALIRSIDBOYOK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |