C18H28N6O — CID 131695049
3-(cyclobutylmethoxymethyl)-8-methyl-7-[(5-methyl-1H-pyrazol-3-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 131695049) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-(cyclobutylmethoxymethyl)-8-methyl-7-[(5-methyl-1H-pyrazol-3-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 3-(cyclobutylmethoxymethyl)-8-methyl-7-[(5-methyl-1H-pyrazol-3-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 131695049 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-(cyclobutylmethoxymethyl)-8-methyl-7-[(5-methyl-1H-pyrazol-3-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | Cc1cc(CN2CCn3c(COCC4CCC4)nnc3CC2C)n[nH]1 |
| InChI | InChI=1S/C18H28N6O/c1-13-8-16(20-19-13)10-23-6-7-24-17(9-14(23)2)21-22-18(24)12-25-11-15-4-3-5-15/h8,14-15H,3-7,9-12H2,1-2H3,(H,19,20) |
| InChIKey | BQSFWKRPHJMTOM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |