About barium(2+);bis(2-oxo-3-phosphonooxypropanoate)
barium(2+);bis(2-oxo-3-phosphonooxypropanoate) (PubChem CID 131698865) has the molecular formula C6H8BaO14P2
and a molecular weight of 503.39 g/mol. Its IUPAC name is barium(2+);bis(2-oxo-3-phosphonooxypropanoate).
Molecular Properties
| Compound Name | barium(2+);bis(2-oxo-3-phosphonooxypropanoate) |
| PubChem CID | 131698865 |
| Molecular Formula | C6H8BaO14P2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.84 |
| IUPAC Name | barium(2+);bis(2-oxo-3-phosphonooxypropanoate) |
| SMILES | O=C([O-])C(=O)COP(=O)(O)O.O=C([O-])C(=O)COP(=O)(O)O.[Ba+2] |
| InChI | InChI=1S/2C3H5O7P.Ba/c2*4-2(3(5)6)1-10-11(7,8)9;/h2*1H2,(H,5,6)(H2,7,8,9);/q;;+2/p-2 |
| InChIKey | LOPGESRQYHGJDB-UHFFFAOYSA-L |
| XLogP | -5.55 |
| TPSA | 247.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-oxo-3-phosphonooxypropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-oxo-3-phosphonooxypropanoate)?
The IUPAC name of barium(2+);bis(2-oxo-3-phosphonooxypropanoate) (CID 131698865) is barium(2+);bis(2-oxo-3-phosphonooxypropanoate).
What is the SMILES notation for barium(2+);bis(2-oxo-3-phosphonooxypropanoate)?
The canonical SMILES for barium(2+);bis(2-oxo-3-phosphonooxypropanoate) is O=C([O-])C(=O)COP(=O)(O)O.O=C([O-])C(=O)COP(=O)(O)O.[Ba+2].
What is the InChIKey of barium(2+);bis(2-oxo-3-phosphonooxypropanoate)?
The InChIKey is LOPGESRQYHGJDB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H5O7P.Ba/c2*4-2(3(5)6)1-10-11(7,8)9;/h2*1H2,(H,5,6)(H2,7,8,9);/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-oxo-3-phosphonooxypropanoate)?
barium(2+);bis(2-oxo-3-phosphonooxypropanoate) has a molecular weight of 503.39 g/mol, XLogP of -5.55, 8 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-oxo-3-phosphonooxypropanoate) is sourced from PubChem (CID 131698865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).