C4H7NO7P- — CID 21145166
2-amino-3-oxo-4-phosphonooxybutanoate (PubChem CID 21145166) has the molecular formula C4H7NO7P- and a molecular weight of 212.07 g/mol. Its IUPAC name is 2-amino-3-oxo-4-phosphonooxybutanoate.
| Compound Name | 2-amino-3-oxo-4-phosphonooxybutanoate |
|---|---|
| PubChem CID | 21145166 |
| Molecular Formula | C4H7NO7P- |
| Molecular Weight | 212.07 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 2-amino-3-oxo-4-phosphonooxybutanoate |
| SMILES | NC(C(=O)[O-])C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C4H8NO7P/c5-3(4(7)8)2(6)1-12-13(9,10)11/h3H,1,5H2,(H,7,8)(H2,9,10,11)/p-1 |
| InChIKey | LMKSRFWSQAKTOE-UHFFFAOYSA-M |
| XLogP | -3.26 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.07 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|