C8H16NO9P — CID 91551550
[(4R,5S)-5-amino-4,6,7-trihydroxy-2,3-dioxooctyl] dihydrogen phosphate (PubChem CID 91551550) has the molecular formula C8H16NO9P and a molecular weight of 301.19 g/mol. Its IUPAC name is [(4R,5S)-5-amino-4,6,7-trihydroxy-2,3-dioxooctyl] dihydrogen phosphate.
| Compound Name | [(4R,5S)-5-amino-4,6,7-trihydroxy-2,3-dioxooctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91551550 |
| Molecular Formula | C8H16NO9P |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [(4R,5S)-5-amino-4,6,7-trihydroxy-2,3-dioxooctyl] dihydrogen phosphate |
| SMILES | CC(O)C(O)[C@H](N)[C@@H](O)C(=O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C8H16NO9P/c1-3(10)6(12)5(9)8(14)7(13)4(11)2-18-19(15,16)17/h3,5-6,8,10,12,14H,2,9H2,1H3,(H2,15,16,17)/t3?,5-,6?,8+/m0/s1 |
| InChIKey | SXVFGIDYRDIMFT-WSHVAKMNSA-N |
| XLogP | -3.34 |
| TPSA | 187.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|