C3H8LiO6P — CID 175521798
lithium;hydride;(3-hydroxy-2-oxopropyl) dihydrogen phosphate (PubChem CID 175521798) has the molecular formula C3H8LiO6P and a molecular weight of 178.01 g/mol. Its IUPAC name is lithium;hydride;(3-hydroxy-2-oxopropyl) dihydrogen phosphate.
| Compound Name | lithium;hydride;(3-hydroxy-2-oxopropyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175521798 |
| Molecular Formula | C3H8LiO6P |
| Molecular Weight | 178.01 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | lithium;hydride;(3-hydroxy-2-oxopropyl) dihydrogen phosphate |
| SMILES | O=C(CO)COP(=O)(O)O.[H-].[Li+] |
| InChI | InChI=1S/C3H7O6P.Li.H/c4-1-3(5)2-9-10(6,7)8;;/h4H,1-2H2,(H2,6,7,8);;/q;+1;-1 |
| InChIKey | VNCZMFGGYWWPQU-UHFFFAOYSA-N |
| XLogP | -4.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.01 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|