C18H17NO2S2 — CID 131703026
1-naphthalen-1-ylsulfonyl-3-thiophen-3-ylpyrrolidine (PubChem CID 131703026) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-naphthalen-1-ylsulfonyl-3-thiophen-3-ylpyrrolidine.
| Compound Name | 1-naphthalen-1-ylsulfonyl-3-thiophen-3-ylpyrrolidine |
|---|---|
| PubChem CID | 131703026 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-naphthalen-1-ylsulfonyl-3-thiophen-3-ylpyrrolidine |
| SMILES | O=S(=O)(c1cccc2ccccc12)N1CCC(c2ccsc2)C1 |
| InChI | InChI=1S/C18H17NO2S2/c20-23(21,18-7-3-5-14-4-1-2-6-17(14)18)19-10-8-15(12-19)16-9-11-22-13-16/h1-7,9,11,13,15H,8,10,12H2 |
| InChIKey | QQZQRPANFNIXCV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |