C24H25NO4S — CID 139619054
3-[4-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenyl]propanoic acid (PubChem CID 139619054) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-[4-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenyl]propanoic acid.
| Compound Name | 3-[4-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139619054 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-[4-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C2CCN(S(=O)(=O)c3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c26-24(27)13-10-18-8-11-19(12-9-18)20-14-16-25(17-15-20)30(28,29)23-7-3-5-21-4-1-2-6-22(21)23/h1-9,11-12,20H,10,13-17H2,(H,26,27) |
| InChIKey | RGECREUZUHJFOQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |