C17H22N2O6S — CID 131704013
N'-(1,3-benzodioxol-5-yl)-N-[[4-(2-hydroxyethoxy)thian-4-yl]methyl]oxamide (PubChem CID 131704013) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[[4-(2-hydroxyethoxy)thian-4-yl]methyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[[4-(2-hydroxyethoxy)thian-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 131704013 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[[4-(2-hydroxyethoxy)thian-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1(OCCO)CCSCC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H22N2O6S/c20-5-6-25-17(3-7-26-8-4-17)10-18-15(21)16(22)19-12-1-2-13-14(9-12)24-11-23-13/h1-2,9,20H,3-8,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | CQZNQHPOEOUFNT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|