C22H31N5O5 — CID 131709958
5-(3-methylbutoxy)-8-prop-2-enyl-2-(2H-tetrazol-5-yl)chromen-4-one;morpholine;hydrate (PubChem CID 131709958) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 5-(3-methylbutoxy)-8-prop-2-enyl-2-(2H-tetrazol-5-yl)chromen-4-one;morpholine;hydrate.
| Compound Name | 5-(3-methylbutoxy)-8-prop-2-enyl-2-(2H-tetrazol-5-yl)chromen-4-one;morpholine;hydrate |
|---|---|
| PubChem CID | 131709958 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 5-(3-methylbutoxy)-8-prop-2-enyl-2-(2H-tetrazol-5-yl)chromen-4-one;morpholine;hydrate |
| SMILES | C1COCCN1.C=CCc1ccc(OCCC(C)C)c2c(=O)cc(-c3nn[nH]n3)oc12.O |
| InChI | InChI=1S/C18H20N4O3.C4H9NO.H2O/c1-4-5-12-6-7-14(24-9-8-11(2)3)16-13(23)10-15(25-17(12)16)18-19-21-22-20-18;1-3-6-4-2-5-1;/h4,6-7,10-11H,1,5,8-9H2,2-3H3,(H,19,20,21,22);5H,1-4H2;1H2 |
| InChIKey | LJFBFNNQJIJPFY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|