C34H30N2O3S — CID 131710044
methyl (6R)-3-benzyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131710044) has the molecular formula C34H30N2O3S and a molecular weight of 546.69 g/mol. Its IUPAC name is methyl (6R)-3-benzyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | methyl (6R)-3-benzyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131710044 |
| Molecular Formula | C34H30N2O3S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | methyl (6R)-3-benzyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(Cc2ccccc2)CS[C@@H]2C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C34H30N2O3S/c1-39-33(38)30-25(22-24-14-6-2-7-15-24)23-40-32-29(31(37)36(30)32)35-34(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21,29,32,35H,22-23H2,1H3/t29?,32-/m1/s1 |
| InChIKey | HFQADCDGXIDNCU-CUPMVOCTSA-N |
| XLogP | 5.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|