C29H25N3O4S2 — CID 57088721
(6S,7R)-3-(3-amino-3-oxoprop-1-enyl)sulfanyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57088721) has the molecular formula C29H25N3O4S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is (6S,7R)-3-(3-amino-3-oxoprop-1-enyl)sulfanyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(3-amino-3-oxoprop-1-enyl)sulfanyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57088721 |
| Molecular Formula | C29H25N3O4S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | (6S,7R)-3-(3-amino-3-oxoprop-1-enyl)sulfanyl-8-oxo-7-(tritylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC(=O)C=CSC1=C(C(=O)O)N2C(=O)[C@@H](NC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]2SC1 |
| InChI | InChI=1S/C29H25N3O4S2/c30-23(33)16-17-37-22-18-38-27-24(26(34)32(27)25(22)28(35)36)31-29(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,24,27,31H,18H2,(H2,30,33)(H,35,36)/t24-,27+/m1/s1 |
| InChIKey | DCXLYPLYQNYOJV-SQHAQQRYSA-N |
| XLogP | 3.88 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|