C14H14N8O5S3 — CID 139757523
(6R)-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139757523) has the molecular formula C14H14N8O5S3 and a molecular weight of 470.52 g/mol. Its IUPAC name is (6R)-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139757523 |
| Molecular Formula | C14H14N8O5S3 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | (6R)-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(N)/C=C/SC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N\O)c3nsc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C14H14N8O5S3/c15-5(16)1-2-28-4-3-29-12-7(11(24)22(12)8(4)13(25)26)18-10(23)6(20-27)9-19-14(17)30-21-9/h1-2,7,12,27H,3H2,(H3,15,16)(H,18,23)(H,25,26)(H2,17,19,21)/b2-1+,20-6-/t7?,12-/m1/s1 |
| InChIKey | CKGYVEKZLLMLNT-NAGPEILASA-N |
| XLogP | -0.82 |
| TPSA | 220.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|