C15H14BrN7O5S3 — CID 139757630
(6R)-7-[[(2Z)-2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139757630) has the molecular formula C15H14BrN7O5S3 and a molecular weight of 548.43 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139757630 |
| Molecular Formula | C15H14BrN7O5S3 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 546.94 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(E)-3-amino-3-iminoprop-1-enyl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(N)/C=C/SC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N\O)c3nc(N)sc3Br)[C@H]2SC1 |
| InChI | InChI=1S/C15H14BrN7O5S3/c16-10-6(21-15(19)31-10)7(22-28)11(24)20-8-12(25)23-9(14(26)27)4(3-30-13(8)23)29-2-1-5(17)18/h1-2,8,13,28H,3H2,(H3,17,18)(H2,19,21)(H,20,24)(H,26,27)/b2-1+,22-7-/t8?,13-/m1/s1 |
| InChIKey | ODRRSOVHUVFWRK-MJTCGJGGSA-N |
| XLogP | 0.55 |
| TPSA | 208.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|