C35H36N2O4 — CID 131717639
(2S)-2-(3-benzoylphenyl)propanoic acid;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 131717639) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2S)-2-(3-benzoylphenyl)propanoic acid;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | (2S)-2-(3-benzoylphenyl)propanoic acid;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 131717639 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (2S)-2-(3-benzoylphenyl)propanoic acid;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12.C[C@H](C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O.C16H14O3/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-7,9,13-14,18-19,22H,1,8,10-12H2;2-11H,1H3,(H,18,19)/t13-,14-,18-,19+;11-/m00/s1 |
| InChIKey | DSTZFBXCDYYOPH-DTROSVQXSA-N |
| XLogP | 6.27 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|