About 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol
1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol (PubChem CID 13171782) has the molecular formula C17H22OS
and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol |
| PubChem CID | 13171782 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol |
| SMILES | CC(C)=C=C(Sc1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C17H22OS/c1-14(2)13-16(17(18)11-7-4-8-12-17)19-15-9-5-3-6-10-15/h3,5-6,9-10,18H,4,7-8,11-12H2,1-2H3 |
| InChIKey | JUNZYADCRDBFAC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol?
The IUPAC name of 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol (CID 13171782) is 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol?
The canonical SMILES for 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol is CC(C)=C=C(Sc1ccccc1)C1(O)CCCCC1.
What is the InChIKey of 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol?
The InChIKey is JUNZYADCRDBFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22OS/c1-14(2)13-16(17(18)11-7-4-8-12-17)19-15-9-5-3-6-10-15/h3,5-6,9-10,18H,4,7-8,11-12H2,1-2H3.
What are the key properties of 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol?
1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol has a molecular weight of 274.43 g/mol, XLogP of 4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1-phenylsulfanylbuta-1,2-dienyl)cyclohexan-1-ol is sourced from PubChem (CID 13171782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).