C37H50O2Si2 — CID 131717831
tert-butyl-[tert-butyl(diphenyl)silyl]oxy-diphenylsilane;pentan-1-ol (PubChem CID 131717831) has the molecular formula C37H50O2Si2 and a molecular weight of 582.98 g/mol. Its IUPAC name is tert-butyl-[tert-butyl(diphenyl)silyl]oxy-diphenylsilane;pentan-1-ol.
| Compound Name | tert-butyl-[tert-butyl(diphenyl)silyl]oxy-diphenylsilane;pentan-1-ol |
|---|---|
| PubChem CID | 131717831 |
| Molecular Formula | C37H50O2Si2 |
| Molecular Weight | 582.98 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | tert-butyl-[tert-butyl(diphenyl)silyl]oxy-diphenylsilane;pentan-1-ol |
| SMILES | CC(C)(C)[Si](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1.CCCCCO |
| InChI | InChI=1S/C32H38OSi2.C5H12O/c1-31(2,3)34(27-19-11-7-12-20-27,28-21-13-8-14-22-28)33-35(32(4,5)6,29-23-15-9-16-24-29)30-25-17-10-18-26-30;1-2-3-4-5-6/h7-26H,1-6H3;6H,2-5H2,1H3 |
| InChIKey | KZJMIGJSHMZGQX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.98 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|