C20H26OS — CID 13171785
1-(2-cyclohexylidene-1-phenylsulfanylethenyl)cyclohexan-1-ol (PubChem CID 13171785) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 1-(2-cyclohexylidene-1-phenylsulfanylethenyl)cyclohexan-1-ol.
| Compound Name | 1-(2-cyclohexylidene-1-phenylsulfanylethenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 13171785 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-(2-cyclohexylidene-1-phenylsulfanylethenyl)cyclohexan-1-ol |
| SMILES | OC1(C(=C=C2CCCCC2)Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H26OS/c21-20(14-8-3-9-15-20)19(16-17-10-4-1-5-11-17)22-18-12-6-2-7-13-18/h2,6-7,12-13,21H,1,3-5,8-11,14-15H2 |
| InChIKey | QUALSXATWSAAEA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |