C15H14N8O4S4 — CID 131718716
(6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 131718716) has the molecular formula C15H14N8O4S4 and a molecular weight of 498.60 g/mol. Its IUPAC name is (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 131718716 |
| Molecular Formula | C15H14N8O4S4 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | Nc1nc(/C(=N\O)C(=O)N[C@@H]2C(=O)N3C(C(=O)S)=C(CSc4ncn[nH]4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C15H14N8O4S4/c16-14-19-6(3-30-14)7(22-27)10(24)20-8-11(25)23-9(13(26)28)5(1-29-12(8)23)2-31-15-17-4-18-21-15/h3-4,8,12,27H,1-2H2,(H2,16,19)(H,20,24)(H,26,28)(H,17,18,21)/b22-7+/t8-,12-/m1/s1 |
| InChIKey | VVRLAQPKGKTFEV-IPKBVDIWSA-N |
| XLogP | -0.08 |
| TPSA | 179.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|