C17H18N6O4S3 — CID 139757500
(6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139757500) has the molecular formula C17H18N6O4S3 and a molecular weight of 466.57 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139757500 |
| Molecular Formula | C17H18N6O4S3 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)NC2C(=O)N3C(C(=O)S)=C(C=C4CCNC4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C17H18N6O4S3/c18-17-20-9(6-30-17)10(22-27)13(24)21-11-14(25)23-12(16(26)28)8(5-29-15(11)23)3-7-1-2-19-4-7/h3,6,11,15,19,27H,1-2,4-5H2,(H2,18,20)(H,21,24)(H,26,28)/b7-3?,22-10-/t11?,15-/m1/s1 |
| InChIKey | PJSXBKJXJXLRNN-JOCLLMAKSA-N |
| XLogP | -0.07 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|