C19H23N5O6S3 — CID 131718598
(6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(2,2-dimethyl-1,3-dioxan-4-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 131718598) has the molecular formula C19H23N5O6S3 and a molecular weight of 513.62 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(2,2-dimethyl-1,3-dioxan-4-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(2,2-dimethyl-1,3-dioxan-4-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 131718598 |
| Molecular Formula | C19H23N5O6S3 |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(2,2-dimethyl-1,3-dioxan-4-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | CC1(C)OCCC(CC2=C(C(=O)S)N3C(=O)C(NC(=O)/C(=N/O)c4csc(N)n4)[C@H]3SC2)O1 |
| InChI | InChI=1S/C19H23N5O6S3/c1-19(2)29-4-3-9(30-19)5-8-6-32-16-12(15(26)24(16)13(8)17(27)31)22-14(25)11(23-28)10-7-33-18(20)21-10/h7,9,12,16,28H,3-6H2,1-2H3,(H2,20,21)(H,22,25)(H,27,31)/b23-11+/t9?,12?,16-/m1/s1 |
| InChIKey | BCSSQYQMNOBMLL-WOEBNIJMSA-N |
| XLogP | 0.95 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|