C50H52F2N6O8 — CID 131722719
(E)-but-2-enedioic acid;bis(6-fluoro-3-[1-[3-(1H-indol-7-yloxy)propyl]piperidin-4-yl]-1,2-benzoxazole) (PubChem CID 131722719) has the molecular formula C50H52F2N6O8 and a molecular weight of 903.00 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(6-fluoro-3-[1-[3-(1H-indol-7-yloxy)propyl]piperidin-4-yl]-1,2-benzoxazole).
| Compound Name | (E)-but-2-enedioic acid;bis(6-fluoro-3-[1-[3-(1H-indol-7-yloxy)propyl]piperidin-4-yl]-1,2-benzoxazole) |
|---|---|
| PubChem CID | 131722719 |
| Molecular Formula | C50H52F2N6O8 |
| Molecular Weight | 903.00 g/mol |
| Exact Mass | 902.38 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(6-fluoro-3-[1-[3-(1H-indol-7-yloxy)propyl]piperidin-4-yl]-1,2-benzoxazole) |
| SMILES | Fc1ccc2c(C3CCN(CCCOc4cccc5cc[nH]c45)CC3)noc2c1.Fc1ccc2c(C3CCN(CCCOc4cccc5cc[nH]c45)CC3)noc2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C23H24FN3O2.C4H4O4/c2*24-18-5-6-19-21(15-18)29-26-22(19)17-8-12-27(13-9-17)11-2-14-28-20-4-1-3-16-7-10-25-23(16)20;5-3(6)1-2-4(7)8/h2*1,3-7,10,15,17,25H,2,8-9,11-14H2;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | WGTJUTCWBPQBNK-WXXKFALUSA-N |
| XLogP | 9.91 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.00 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|