C12H24N2O4 — CID 131723438
(2S)-2,6-diaminohexanoic acid;2-(prop-2-enoxymethyl)oxirane (PubChem CID 131723438) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;2-(prop-2-enoxymethyl)oxirane.
| Compound Name | (2S)-2,6-diaminohexanoic acid;2-(prop-2-enoxymethyl)oxirane |
|---|---|
| PubChem CID | 131723438 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;2-(prop-2-enoxymethyl)oxirane |
| SMILES | C=CCOCC1CO1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C6H10O2/c7-4-2-1-3-5(8)6(9)10;1-2-3-7-4-6-5-8-6/h5H,1-4,7-8H2,(H,9,10);2,6H,1,3-5H2/t5-;/m0./s1 |
| InChIKey | JLTBHVCDWPAURY-JEDNCBNOSA-N |
| XLogP | 0.12 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|