C29H28N4O3 — CID 131725401
(2S)-1-benzoyl-N-(9-ethylcarbazol-3-yl)-4-prop-2-enoxyiminopyrrolidine-2-carboxamide (PubChem CID 131725401) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is (2S)-1-benzoyl-N-(9-ethylcarbazol-3-yl)-4-prop-2-enoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-benzoyl-N-(9-ethylcarbazol-3-yl)-4-prop-2-enoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131725401 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (2S)-1-benzoyl-N-(9-ethylcarbazol-3-yl)-4-prop-2-enoxyiminopyrrolidine-2-carboxamide |
| SMILES | C=CCON=C1C[C@@H](C(=O)Nc2ccc3c(c2)c2ccccc2n3CC)N(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H28N4O3/c1-3-16-36-31-22-18-27(33(19-22)29(35)20-10-6-5-7-11-20)28(34)30-21-14-15-26-24(17-21)23-12-8-9-13-25(23)32(26)4-2/h3,5-15,17,27H,1,4,16,18-19H2,2H3,(H,30,34)/t27-/m0/s1 |
| InChIKey | GEXKXPRVGYNBJR-MHZLTWQESA-N |
| XLogP | 5.23 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|