C28H34N2O4Si — CID 131725997
5-(2-tert-butylsilyloxypropan-2-yl)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4H-1,2-oxazole-5-carbaldehyde (PubChem CID 131725997) has the molecular formula C28H34N2O4Si and a molecular weight of 490.68 g/mol. Its IUPAC name is 5-(2-tert-butylsilyloxypropan-2-yl)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4H-1,2-oxazole-5-carbaldehyde.
| Compound Name | 5-(2-tert-butylsilyloxypropan-2-yl)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4H-1,2-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 131725997 |
| Molecular Formula | C28H34N2O4Si |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 5-(2-tert-butylsilyloxypropan-2-yl)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-4H-1,2-oxazole-5-carbaldehyde |
| SMILES | Cc1cc(COc2ccc(C3=NOC(C=O)(C(C)(C)O[SiH2]C(C)(C)C)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C28H34N2O4Si/c1-19-15-21(23-9-7-8-10-24(23)29-19)17-32-22-13-11-20(12-14-22)25-16-28(18-31,33-30-25)27(5,6)34-35-26(2,3)4/h7-15,18H,16-17,35H2,1-6H3 |
| InChIKey | KETZYZQSJPOTES-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|