C22H30N2O5 — CID 131726230
tert-butyl N-[2-(2-hydroxyethyl)-3-methoxyphenyl]carbamate;2,3-dihydro-1-benzofuran-4-amine (PubChem CID 131726230) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxyethyl)-3-methoxyphenyl]carbamate;2,3-dihydro-1-benzofuran-4-amine.
| Compound Name | tert-butyl N-[2-(2-hydroxyethyl)-3-methoxyphenyl]carbamate;2,3-dihydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 131726230 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxyethyl)-3-methoxyphenyl]carbamate;2,3-dihydro-1-benzofuran-4-amine |
| SMILES | COc1cccc(NC(=O)OC(C)(C)C)c1CCO.Nc1cccc2c1CCO2 |
| InChI | InChI=1S/C14H21NO4.C8H9NO/c1-14(2,3)19-13(17)15-11-6-5-7-12(18-4)10(11)8-9-16;9-7-2-1-3-8-6(7)4-5-10-8/h5-7,16H,8-9H2,1-4H3,(H,15,17);1-3H,4-5,9H2 |
| InChIKey | XUKYPMZVEBTHBV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|