C25H28Cl2N4O4 — CID 131726418
[(2S)-1-[4-(3,4-dichlorophenyl)benzoyl]-4-methoxyiminopyrrolidin-2-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 131726418) has the molecular formula C25H28Cl2N4O4 and a molecular weight of 519.43 g/mol. Its IUPAC name is [(2S)-1-[4-(3,4-dichlorophenyl)benzoyl]-4-methoxyiminopyrrolidin-2-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[4-(3,4-dichlorophenyl)benzoyl]-4-methoxyiminopyrrolidin-2-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 131726418 |
| Molecular Formula | C25H28Cl2N4O4 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [(2S)-1-[4-(3,4-dichlorophenyl)benzoyl]-4-methoxyiminopyrrolidin-2-yl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | CON=C1C[C@@H](C(=O)N2CCN(CCO)CC2)N(C(=O)c2ccc(-c3ccc(Cl)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C25H28Cl2N4O4/c1-35-28-20-15-23(25(34)30-10-8-29(9-11-30)12-13-32)31(16-20)24(33)18-4-2-17(3-5-18)19-6-7-21(26)22(27)14-19/h2-7,14,23,32H,8-13,15-16H2,1H3/t23-/m0/s1 |
| InChIKey | LMLIZYRZINNREE-QHCPKHFHSA-N |
| XLogP | 3.01 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|