C7H13Cl2O2- — CID 131726682
4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride (PubChem CID 131726682) has the molecular formula C7H13Cl2O2- and a molecular weight of 200.08 g/mol. Its IUPAC name is 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride.
| Compound Name | 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride |
|---|---|
| PubChem CID | 131726682 |
| Molecular Formula | C7H13Cl2O2- |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride |
| SMILES | COC(OC)C(C)=CCCl.[Cl-] |
| InChI | InChI=1S/C7H13ClO2.ClH/c1-6(4-5-8)7(9-2)10-3;/h4,7H,5H2,1-3H3;1H/p-1 |
| InChIKey | FKXVYCCWPIHFEE-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|