4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride

C7H13Cl2O2- — CID 131726682

IUPAC4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride
SMILESCOC(OC)C(C)=CCCl.[Cl-]
InChIInChI=1S/C7H13ClO2.ClH/c1-6(4-5-8)7(9-2)10-3;/h4,7H,5H2,1-3H3;1H/p-1
InChIKeyFKXVYCCWPIHFEE-UHFFFAOYSA-M
MW200.08 g/mol
LogP-1.21
Rot. Bonds4

About 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride

4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride (PubChem CID 131726682) has the molecular formula C7H13Cl2O2- and a molecular weight of 200.08 g/mol. Its IUPAC name is 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride.

Molecular Properties

Compound Name4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride
PubChem CID131726682
Molecular FormulaC7H13Cl2O2-
Molecular Weight200.08 g/mol
Exact Mass199.03
IUPAC Name4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride
SMILESCOC(OC)C(C)=CCCl.[Cl-]
InChIInChI=1S/C7H13ClO2.ClH/c1-6(4-5-8)7(9-2)10-3;/h4,7H,5H2,1-3H3;1H/p-1
InChIKeyFKXVYCCWPIHFEE-UHFFFAOYSA-M
XLogP-1.21
TPSA18.46 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.08
LogP ≤ 5-1.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride?
The IUPAC name of 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride (CID 131726682) is 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride.
What is the SMILES notation for 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride?
The canonical SMILES for 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride is COC(OC)C(C)=CCCl.[Cl-].
What is the InChIKey of 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride?
The InChIKey is FKXVYCCWPIHFEE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13ClO2.ClH/c1-6(4-5-8)7(9-2)10-3;/h4,7H,5H2,1-3H3;1H/p-1.
What are the key properties of 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride?
4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride has a molecular weight of 200.08 g/mol, XLogP of -1.21, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,1-dimethoxy-2-methylbut-2-ene chloride is sourced from PubChem (CID 131726682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).